C12H20O4 — CID 11322138
(1'S,3'R,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-ol (PubChem CID 11322138) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1'S,3'R,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-ol.
| Compound Name | (1'S,3'R,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-ol |
|---|---|
| PubChem CID | 11322138 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (1'S,3'R,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-ol |
| SMILES | CC1(C)OCC[C@]2(C[C@H](O)C[C@@H]3O[C@@]32C)O1 |
| InChI | InChI=1S/C12H20O4/c1-10(2)14-5-4-12(16-10)7-8(13)6-9-11(12,3)15-9/h8-9,13H,4-7H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | QOCLMMBCXZJCOW-LLHIFLOGSA-N |
| XLogP | 1.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|