C18H34O4Si — CID 11175288
tert-butyl-dimethyl-[(1'S,3'S,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-yl]oxysilane (PubChem CID 11175288) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1'S,3'S,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1'S,3'S,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-yl]oxysilane |
|---|---|
| PubChem CID | 11175288 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | tert-butyl-dimethyl-[(1'S,3'S,4R,6'S)-2,2,6'-trimethylspiro[1,3-dioxane-4,5'-7-oxabicyclo[4.1.0]heptane]-3'-yl]oxysilane |
| SMILES | CC1(C)OCC[C@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3O[C@@]32C)O1 |
| InChI | InChI=1S/C18H34O4Si/c1-15(2,3)23(7,8)21-13-11-14-17(6,20-14)18(12-13)9-10-19-16(4,5)22-18/h13-14H,9-12H2,1-8H3/t13-,14-,17-,18+/m0/s1 |
| InChIKey | FPPBOHOFWONZLS-DFEHZGFQSA-N |
| XLogP | 4.24 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|