C28H34N2O4 — CID 139039107
(2R,3aR)-3a-methoxy-2-methyl-4,5-dihydro-3H-benzo[g]indol-2-ol (PubChem CID 139039107) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2R,3aR)-3a-methoxy-2-methyl-4,5-dihydro-3H-benzo[g]indol-2-ol.
| Compound Name | (2R,3aR)-3a-methoxy-2-methyl-4,5-dihydro-3H-benzo[g]indol-2-ol |
|---|---|
| PubChem CID | 139039107 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (2R,3aR)-3a-methoxy-2-methyl-4,5-dihydro-3H-benzo[g]indol-2-ol |
| SMILES | CO[C@@]12CCc3ccccc3C1=N[C@](C)(O)C2.CO[C@@]12CCc3ccccc3C1=N[C@](C)(O)C2 |
| InChI | InChI=1S/2C14H17NO2/c2*1-13(16)9-14(17-2)8-7-10-5-3-4-6-11(10)12(14)15-13/h2*3-6,16H,7-9H2,1-2H3/t2*13-,14-/m11/s1 |
| InChIKey | YKQLQZCGYGCKOY-IWYXBRTKSA-N |
| XLogP | 3.84 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |