C38H46N2O2 — CID 139039670
(S)-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-phenylmethanol (PubChem CID 139039670) has the molecular formula C38H46N2O2 and a molecular weight of 562.80 g/mol. Its IUPAC name is (S)-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-phenylmethanol.
| Compound Name | (S)-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 139039670 |
| Molecular Formula | C38H46N2O2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | (S)-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-phenylmethanol |
| SMILES | CC(C)(C)N1[C@@H]([C@@H](O)c2ccccc2)[C@H]1c1ccccc1.CC(C)(C)N1[C@@H]([C@@H](O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/2C19H23NO/c2*1-19(2,3)20-16(14-10-6-4-7-11-14)17(20)18(21)15-12-8-5-9-13-15/h2*4-13,16-18,21H,1-3H3/t2*16-,17-,18+,20?/m11/s1 |
| InChIKey | BOBVVYTXXPUPPJ-APLQYGOGSA-N |
| XLogP | 7.89 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|