C42H50N4 — CID 139041177
(4Z,6Z)-4-N,7-N-bis(benzhydrylideneamino)-5,6-dipropyldeca-4,6-diene-4,7-diamine (PubChem CID 139041177) has the molecular formula C42H50N4 and a molecular weight of 610.89 g/mol. Its IUPAC name is (4Z,6Z)-4-N,7-N-bis(benzhydrylideneamino)-5,6-dipropyldeca-4,6-diene-4,7-diamine.
| Compound Name | (4Z,6Z)-4-N,7-N-bis(benzhydrylideneamino)-5,6-dipropyldeca-4,6-diene-4,7-diamine |
|---|---|
| PubChem CID | 139041177 |
| Molecular Formula | C42H50N4 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.40 |
| IUPAC Name | (4Z,6Z)-4-N,7-N-bis(benzhydrylideneamino)-5,6-dipropyldeca-4,6-diene-4,7-diamine |
| SMILES | CCC/C(NN=C(c1ccccc1)c1ccccc1)=C(CCC)/C(CCC)=C(/CCC)NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H50N4/c1-5-21-37(39(23-7-3)43-45-41(33-25-13-9-14-26-33)34-27-15-10-16-28-34)38(22-6-2)40(24-8-4)44-46-42(35-29-17-11-18-30-35)36-31-19-12-20-32-36/h9-20,25-32,43-44H,5-8,21-24H2,1-4H3/b39-37-,40-38- |
| InChIKey | LVEDHXXLCXNBCX-YKSAKOAQSA-N |
| XLogP | 10.78 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|