C46H38N4 — CID 139041176
(Z)-N-(benzhydrylideneamino)-1-[2-[(Z)-N-(benzhydrylideneamino)-C-phenylcarbonimidoyl]cyclohexen-1-yl]-1-phenylmethanimine (PubChem CID 139041176) has the molecular formula C46H38N4 and a molecular weight of 646.84 g/mol. Its IUPAC name is (Z)-N-(benzhydrylideneamino)-1-[2-[(Z)-N-(benzhydrylideneamino)-C-phenylcarbonimidoyl]cyclohexen-1-yl]-1-phenylmethanimine.
| Compound Name | (Z)-N-(benzhydrylideneamino)-1-[2-[(Z)-N-(benzhydrylideneamino)-C-phenylcarbonimidoyl]cyclohexen-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 139041176 |
| Molecular Formula | C46H38N4 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (Z)-N-(benzhydrylideneamino)-1-[2-[(Z)-N-(benzhydrylideneamino)-C-phenylcarbonimidoyl]cyclohexen-1-yl]-1-phenylmethanimine |
| SMILES | c1ccc(C(=N/N=C(\C2=C(/C(=N\N=C(c3ccccc3)c3ccccc3)c3ccccc3)CCCC2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H38N4/c1-7-21-35(22-8-1)43(36-23-9-2-10-24-36)47-49-45(39-29-15-5-16-30-39)41-33-19-20-34-42(41)46(40-31-17-6-18-32-40)50-48-44(37-25-11-3-12-26-37)38-27-13-4-14-28-38/h1-18,21-32H,19-20,33-34H2/b49-45-,50-46- |
| InChIKey | RMZYLTVSBLGFFP-FXVBOROLSA-N |
| XLogP | 10.74 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|