C15H8F5NO3 — CID 139042555
[(E)-benzylideneamino] (2,3,4,5,6-pentafluorophenyl)methyl carbonate (PubChem CID 139042555) has the molecular formula C15H8F5NO3 and a molecular weight of 345.22 g/mol. Its IUPAC name is [(E)-benzylideneamino] (2,3,4,5,6-pentafluorophenyl)methyl carbonate.
| Compound Name | [(E)-benzylideneamino] (2,3,4,5,6-pentafluorophenyl)methyl carbonate |
|---|---|
| PubChem CID | 139042555 |
| Molecular Formula | C15H8F5NO3 |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [(E)-benzylideneamino] (2,3,4,5,6-pentafluorophenyl)methyl carbonate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)O/N=C/c1ccccc1 |
| InChI | InChI=1S/C15H8F5NO3/c16-10-9(11(17)13(19)14(20)12(10)18)7-23-15(22)24-21-6-8-4-2-1-3-5-8/h1-6H,7H2/b21-6+ |
| InChIKey | URQASTFVOVSFCG-AERZKKPOSA-N |
| XLogP | 4.07 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|