About [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate
[(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate (PubChem CID 139042553) has the molecular formula C15H12FNO3
and a molecular weight of 273.26 g/mol. Its IUPAC name is [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate.
Molecular Properties
| Compound Name | [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate |
| PubChem CID | 139042553 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate |
| SMILES | O=C(OCc1ccc(F)cc1)O/N=C/c1ccccc1 |
| InChI | InChI=1S/C15H12FNO3/c16-14-8-6-13(7-9-14)11-19-15(18)20-17-10-12-4-2-1-3-5-12/h1-10H,11H2/b17-10+ |
| InChIKey | KNIIMKNQVOFWTG-LICLKQGHSA-N |
| XLogP | 3.51 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate?
The IUPAC name of [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate (CID 139042553) is [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate.
What is the SMILES notation for [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate?
The canonical SMILES for [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate is O=C(OCc1ccc(F)cc1)O/N=C/c1ccccc1.
What is the InChIKey of [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate?
The InChIKey is KNIIMKNQVOFWTG-LICLKQGHSA-N. The full InChI is InChI=1S/C15H12FNO3/c16-14-8-6-13(7-9-14)11-19-15(18)20-17-10-12-4-2-1-3-5-12/h1-10H,11H2/b17-10+.
What are the key properties of [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate?
[(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate has a molecular weight of 273.26 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-benzylideneamino] (4-fluorophenyl)methyl carbonate is sourced from PubChem (CID 139042553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).