C40H20F10O6 — CID 139043961
bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate (PubChem CID 139043961) has the molecular formula C40H20F10O6 and a molecular weight of 786.57 g/mol. Its IUPAC name is bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate.
| Compound Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139043961 |
| Molecular Formula | C40H20F10O6 |
| Molecular Weight | 786.57 g/mol |
| Exact Mass | 786.11 |
| IUPAC Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate |
| SMILES | COc1ccc(C#Cc2cc(C(=O)OCc3c(F)c(F)c(F)c(F)c3F)c(C#Cc3ccc(OC)cc3)cc2C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C40H20F10O6/c1-53-23-11-5-19(6-12-23)3-9-21-15-26(40(52)56-18-28-31(43)35(47)38(50)36(48)32(28)44)22(10-4-20-7-13-24(54-2)14-8-20)16-25(21)39(51)55-17-27-29(41)33(45)37(49)34(46)30(27)42/h5-8,11-16H,17-18H2,1-2H3 |
| InChIKey | QKBKIMMPLYKXBA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.57 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|