C24H28N2S — CID 139044352
1,4-dibenzyl-3-cyclopropyl-5-(2-methylpropyl)imidazole-2-thione (PubChem CID 139044352) has the molecular formula C24H28N2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 1,4-dibenzyl-3-cyclopropyl-5-(2-methylpropyl)imidazole-2-thione.
| Compound Name | 1,4-dibenzyl-3-cyclopropyl-5-(2-methylpropyl)imidazole-2-thione |
|---|---|
| PubChem CID | 139044352 |
| Molecular Formula | C24H28N2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1,4-dibenzyl-3-cyclopropyl-5-(2-methylpropyl)imidazole-2-thione |
| SMILES | CC(C)Cc1c(Cc2ccccc2)n(C2CC2)c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2S/c1-18(2)15-22-23(16-19-9-5-3-6-10-19)26(21-13-14-21)24(27)25(22)17-20-11-7-4-8-12-20/h3-12,18,21H,13-17H2,1-2H3 |
| InChIKey | NKMNNLJANQYIIE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|