C51H33AuN6O2 — CID 139047689
benzene;4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)corrin-5,10,15-triylium-21,22,23,24-tetraid-5-yl]benzonitrile;gold(1+) (PubChem CID 139047689) has the molecular formula C51H33AuN6O2 and a molecular weight of 958.83 g/mol. Its IUPAC name is benzene;4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)corrin-5,10,15-triylium-21,22,23,24-tetraid-5-yl]benzonitrile;gold(1+).
| Compound Name | benzene;4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)corrin-5,10,15-triylium-21,22,23,24-tetraid-5-yl]benzonitrile;gold(1+) |
|---|---|
| PubChem CID | 139047689 |
| Molecular Formula | C51H33AuN6O2 |
| Molecular Weight | 958.83 g/mol |
| Exact Mass | 958.23 |
| IUPAC Name | benzene;4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)corrin-5,10,15-triylium-21,22,23,24-tetraid-5-yl]benzonitrile;gold(1+) |
| SMILES | COc1ccc2c(OC)ccc([C+]3c4ccc([n-]4)[C+](c4ccc(C#N)cc4)c4ccc([n-]4)-c4ccc([n-]4)[C+](c4ccc(C#N)cc4)c4ccc3[n-]4)c2c1.[Au+].c1ccccc1 |
| InChI | InChI=1S/C45H27N6O2.C6H6.Au/c1-52-30-11-12-31-33(23-30)32(13-22-42(31)53-2)45-40-20-18-38(50-40)43(28-7-3-26(24-46)4-8-28)36-16-14-34(48-36)35-15-17-37(49-35)44(39-19-21-41(45)51-39)29-9-5-27(25-47)6-10-29;1-2-4-6-5-3-1;/h3-23H,1-2H3;1-6H;/q-1;;+1 |
| InChIKey | CHSIUBNQXUESIB-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 122.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|