C45H31N6O2+3 — CID 139047690
4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)-21,22,23,24-tetrahydrocorrin-5,10,15-triylium-5-yl]benzonitrile (PubChem CID 139047690) has the molecular formula C45H31N6O2+3 and a molecular weight of 687.78 g/mol. Its IUPAC name is 4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)-21,22,23,24-tetrahydrocorrin-5,10,15-triylium-5-yl]benzonitrile.
| Compound Name | 4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)-21,22,23,24-tetrahydrocorrin-5,10,15-triylium-5-yl]benzonitrile |
|---|---|
| PubChem CID | 139047690 |
| Molecular Formula | C45H31N6O2+3 |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 4-[15-(4-cyanophenyl)-10-(4,7-dimethoxynaphthalen-1-yl)-21,22,23,24-tetrahydrocorrin-5,10,15-triylium-5-yl]benzonitrile |
| SMILES | COc1ccc2c(OC)ccc([C+]3c4ccc([nH]4)[C+](c4ccc(C#N)cc4)c4ccc([nH]4)-c4ccc([nH]4)[C+](c4ccc(C#N)cc4)c4ccc3[nH]4)c2c1 |
| InChI | InChI=1S/C45H31N6O2/c1-52-30-11-12-31-33(23-30)32(13-22-42(31)53-2)45-40-20-18-38(50-40)43(28-7-3-26(24-46)4-8-28)36-16-14-34(48-36)35-15-17-37(49-35)44(39-19-21-41(45)51-39)29-9-5-27(25-47)6-10-29/h3-23,48-51H,1-2H3/q+3 |
| InChIKey | VFIDLSARBMHQLF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|