C59H52N4O2Zn — CID 56654305
zinc 5-(4,7-dimethoxynaphthalen-1-yl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide (PubChem CID 56654305) has the molecular formula C59H52N4O2Zn and a molecular weight of 914.48 g/mol. Its IUPAC name is zinc 5-(4,7-dimethoxynaphthalen-1-yl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-(4,7-dimethoxynaphthalen-1-yl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 56654305 |
| Molecular Formula | C59H52N4O2Zn |
| Molecular Weight | 914.48 g/mol |
| Exact Mass | 912.34 |
| IUPAC Name | zinc 5-(4,7-dimethoxynaphthalen-1-yl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
| SMILES | COc1ccc2c(OC)ccc(-c3c4nc(c(-c5c(C)cc(C)cc5C)c5ccc([n-]5)c(-c5c(C)cc(C)cc5C)c5nc(c(-c6c(C)cc(C)cc6C)c6ccc3[n-]6)C=C5)C=C4)c2c1.[Zn+2] |
| InChI | InChI=1S/C59H52N4O2.Zn/c1-31-24-34(4)53(35(5)25-31)57-46-17-15-44(60-46)56(42-14-23-52(65-11)41-13-12-40(64-10)30-43(41)42)45-16-18-47(61-45)58(54-36(6)26-32(2)27-37(54)7)49-20-22-51(63-49)59(50-21-19-48(57)62-50)55-38(8)28-33(3)29-39(55)9;/h12-30H,1-11H3;/q-2;+2/b56-44-,56-45-,57-46+,57-48+,58-47+,58-49+,59-50+,59-51+; |
| InChIKey | YVMNNDKSTNSZHH-BLUMVRTMSA-N |
| XLogP | 14.53 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.48 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|