C32H32O4S — CID 139047862
(1S,2S,4R)-6,7-dimethoxy-4-methyl-2-(4-methylphenyl)sulfonyl-1-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139047862) has the molecular formula C32H32O4S and a molecular weight of 512.67 g/mol. Its IUPAC name is (1S,2S,4R)-6,7-dimethoxy-4-methyl-2-(4-methylphenyl)sulfonyl-1-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,2S,4R)-6,7-dimethoxy-4-methyl-2-(4-methylphenyl)sulfonyl-1-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139047862 |
| Molecular Formula | C32H32O4S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (1S,2S,4R)-6,7-dimethoxy-4-methyl-2-(4-methylphenyl)sulfonyl-1-(4-phenylphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc2c(cc1OC)[C@H](C)C[C@H](S(=O)(=O)c1ccc(C)cc1)[C@H]2c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32O4S/c1-21-10-16-26(17-11-21)37(33,34)31-18-22(2)27-19-29(35-3)30(36-4)20-28(27)32(31)25-14-12-24(13-15-25)23-8-6-5-7-9-23/h5-17,19-20,22,31-32H,18H2,1-4H3/t22-,31+,32+/m1/s1 |
| InChIKey | DCVCWAPBXRSVSV-PDXWSVEKSA-N |
| XLogP | 7.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |