C44H30F6O2S2 — CID 139048433
2,2-diphenyl-4-(trifluoromethylsulfanyl)chromene (PubChem CID 139048433) has the molecular formula C44H30F6O2S2 and a molecular weight of 768.84 g/mol. Its IUPAC name is 2,2-diphenyl-4-(trifluoromethylsulfanyl)chromene.
| Compound Name | 2,2-diphenyl-4-(trifluoromethylsulfanyl)chromene |
|---|---|
| PubChem CID | 139048433 |
| Molecular Formula | C44H30F6O2S2 |
| Molecular Weight | 768.84 g/mol |
| Exact Mass | 768.16 |
| IUPAC Name | 2,2-diphenyl-4-(trifluoromethylsulfanyl)chromene |
| SMILES | FC(F)(F)SC1=CC(c2ccccc2)(c2ccccc2)Oc2ccccc21.FC(F)(F)SC1=CC(c2ccccc2)(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/2C22H15F3OS/c2*23-22(24,25)27-20-15-21(16-9-3-1-4-10-16,17-11-5-2-6-12-17)26-19-14-8-7-13-18(19)20/h2*1-15H |
| InChIKey | VMUYOJCTVJXKMZ-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.84 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |