About 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform
2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform (PubChem CID 139048437) has the molecular formula C25H20Cl3F3O3S
and a molecular weight of 563.85 g/mol. Its IUPAC name is 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform.
Molecular Properties
| Compound Name | 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform |
| PubChem CID | 139048437 |
| Molecular Formula | C25H20Cl3F3O3S |
| Molecular Weight | 563.85 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform |
| SMILES | COc1ccccc1C1(c2ccccc2OC)C=C(SC(F)(F)F)c2ccccc2O1.ClC(Cl)Cl |
| InChI | InChI=1S/C24H19F3O3S.CHCl3/c1-28-20-13-7-4-10-17(20)23(18-11-5-8-14-21(18)29-2)15-22(31-24(25,26)27)16-9-3-6-12-19(16)30-23;2-1(3)4/h3-15H,1-2H3;1H |
| InChIKey | GJCPVUOXGXBNRS-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.85 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform?
The IUPAC name of 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform (CID 139048437) is 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform.
What is the SMILES notation for 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform?
The canonical SMILES for 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform is COc1ccccc1C1(c2ccccc2OC)C=C(SC(F)(F)F)c2ccccc2O1.ClC(Cl)Cl.
What is the InChIKey of 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform?
The InChIKey is GJCPVUOXGXBNRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3O3S.CHCl3/c1-28-20-13-7-4-10-17(20)23(18-11-5-8-14-21(18)29-2)15-22(31-24(25,26)27)16-9-3-6-12-19(16)30-23;2-1(3)4/h3-15H,1-2H3;1H.
What are the key properties of 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform?
2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform has a molecular weight of 563.85 g/mol, XLogP of 8.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene;chloroform is sourced from PubChem (CID 139048437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).