C24H19F3O3S — CID 139048438
2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene (PubChem CID 139048438) has the molecular formula C24H19F3O3S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene.
| Compound Name | 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene |
|---|---|
| PubChem CID | 139048438 |
| Molecular Formula | C24H19F3O3S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2,2-bis(2-methoxyphenyl)-4-(trifluoromethylsulfanyl)chromene |
| SMILES | COc1ccccc1C1(c2ccccc2OC)C=C(SC(F)(F)F)c2ccccc2O1 |
| InChI | InChI=1S/C24H19F3O3S/c1-28-20-13-7-4-10-17(20)23(18-11-5-8-14-21(18)29-2)15-22(31-24(25,26)27)16-9-3-6-12-19(16)30-23/h3-15H,1-2H3 |
| InChIKey | JIYNCPWOYZOAAC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |