C19H22N2O2 — CID 139048959
1-[(1R,15R)-3,13-diazapentacyclo[13.3.1.01,13.02,10.04,9]nonadeca-2(10),4,6,8,17-pentaen-17-yl]ethanone;hydrate (PubChem CID 139048959) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[(1R,15R)-3,13-diazapentacyclo[13.3.1.01,13.02,10.04,9]nonadeca-2(10),4,6,8,17-pentaen-17-yl]ethanone;hydrate.
| Compound Name | 1-[(1R,15R)-3,13-diazapentacyclo[13.3.1.01,13.02,10.04,9]nonadeca-2(10),4,6,8,17-pentaen-17-yl]ethanone;hydrate |
|---|---|
| PubChem CID | 139048959 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(1R,15R)-3,13-diazapentacyclo[13.3.1.01,13.02,10.04,9]nonadeca-2(10),4,6,8,17-pentaen-17-yl]ethanone;hydrate |
| SMILES | CC(=O)C1=C[C@@]23C[C@@H](C1)CN2CCc1c3[nH]c2ccccc12.O |
| InChI | InChI=1S/C19H20N2O.H2O/c1-12(22)14-8-13-9-19(10-14)18-16(6-7-21(19)11-13)15-4-2-3-5-17(15)20-18;/h2-5,10,13,20H,6-9,11H2,1H3;1H2/t13-,19-;/m1./s1 |
| InChIKey | YYDLRAOKQFIMBP-NXDRBNLFSA-N |
| XLogP | 2.34 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |