C27H28N2O — CID 91319089
(1S)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one (PubChem CID 91319089) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is (1S)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one.
| Compound Name | (1S)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
|---|---|
| PubChem CID | 91319089 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (1S)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
| SMILES | C[C@@]12CC3CC(=O)C(=Cc4ccccc4)CC3CN1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C27H28N2O/c1-27-16-20-15-25(30)19(13-18-7-3-2-4-8-18)14-21(20)17-29(27)12-11-23-22-9-5-6-10-24(22)28-26(23)27/h2-10,13,20-21,28H,11-12,14-17H2,1H3/t20?,21?,27-/m0/s1 |
| InChIKey | SCNGDCUYJMDHHY-HTLZXYJSSA-N |
| XLogP | 5.32 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|