C22H26N2O — CID 70159214
(15S,20S)-1-prop-2-enyl-3,11,12,14,15,16,17,19,20,21-decahydroyohimban-18-one (PubChem CID 70159214) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (15S,20S)-1-prop-2-enyl-3,11,12,14,15,16,17,19,20,21-decahydroyohimban-18-one.
| Compound Name | (15S,20S)-1-prop-2-enyl-3,11,12,14,15,16,17,19,20,21-decahydroyohimban-18-one |
|---|---|
| PubChem CID | 70159214 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (15S,20S)-1-prop-2-enyl-3,11,12,14,15,16,17,19,20,21-decahydroyohimban-18-one |
| SMILES | C=CCC12C[C@H]3CC(=O)CC[C@@H]3CN1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C22H26N2O/c1-2-10-22-13-16-12-17(25)8-7-15(16)14-24(22)11-9-19-18-5-3-4-6-20(18)23-21(19)22/h2-6,15-16,23H,1,7-14H2/t15-,16-,22?/m1/s1 |
| InChIKey | WDPRJFUEWHGCDS-AXJGWOQESA-N |
| XLogP | 4.19 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|