C29H32N2O3 — CID 20703677
(17E)-17-[(3,5-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one (PubChem CID 20703677) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (17E)-17-[(3,5-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one.
| Compound Name | (17E)-17-[(3,5-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
|---|---|
| PubChem CID | 20703677 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (17E)-17-[(3,5-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
| SMILES | COc1cc(/C=C2\CC3CN4CCc5c([nH]c6ccccc56)C4(C)CC3CC2=O)cc(OC)c1 |
| InChI | InChI=1S/C29H32N2O3/c1-29-16-20-14-27(32)19(10-18-11-22(33-2)15-23(12-18)34-3)13-21(20)17-31(29)9-8-25-24-6-4-5-7-26(24)30-28(25)29/h4-7,10-12,15,20-21,30H,8-9,13-14,16-17H2,1-3H3/b19-10+ |
| InChIKey | ADUZGOARBJZSOI-VXLYETTFSA-N |
| XLogP | 5.34 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|