C27H29N3O3 — CID 10297221
(1S,17E,18S)-17-benzylidene-1-methyl-7-nitro-3,11,12,14,15,16,18,19,20,21-decahydroyohimban-18-ol (PubChem CID 10297221) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (1S,17E,18S)-17-benzylidene-1-methyl-7-nitro-3,11,12,14,15,16,18,19,20,21-decahydroyohimban-18-ol.
| Compound Name | (1S,17E,18S)-17-benzylidene-1-methyl-7-nitro-3,11,12,14,15,16,18,19,20,21-decahydroyohimban-18-ol |
|---|---|
| PubChem CID | 10297221 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (1S,17E,18S)-17-benzylidene-1-methyl-7-nitro-3,11,12,14,15,16,18,19,20,21-decahydroyohimban-18-ol |
| SMILES | C[C@@]12CC3C[C@H](O)/C(=C/c4ccccc4)CC3CN1CCc1c2[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C27H29N3O3/c1-27-15-19-13-25(31)18(11-17-5-3-2-4-6-17)12-20(19)16-29(27)10-9-22-23-14-21(30(32)33)7-8-24(23)28-26(22)27/h2-8,11,14,19-20,25,28,31H,9-10,12-13,15-16H2,1H3/b18-11+/t19?,20?,25-,27-/m0/s1 |
| InChIKey | LPELWZUNFHBNSY-PBZREBQESA-N |
| XLogP | 5.02 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|