C27H29N3O — CID 20703671
(NZ)-N-[(17E)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-ylidene]hydroxylamine (PubChem CID 20703671) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is (NZ)-N-[(17E)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(17E)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 20703671 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (NZ)-N-[(17E)-17-benzylidene-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-ylidene]hydroxylamine |
| SMILES | CC12CC3CC(=N/O)/C(=C/c4ccccc4)CC3CN1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C27H29N3O/c1-27-16-20-15-25(29-31)19(13-18-7-3-2-4-8-18)14-21(20)17-30(27)12-11-23-22-9-5-6-10-24(22)28-26(23)27/h2-10,13,20-21,28,31H,11-12,14-17H2,1H3/b19-13+,29-25- |
| InChIKey | MMBKFMSBDXYWQM-KAVNCWJOSA-N |
| XLogP | 5.58 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|