C29H32N2O3 — CID 91115442
(1S)-17-[(3,4-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one (PubChem CID 91115442) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1S)-17-[(3,4-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one.
| Compound Name | (1S)-17-[(3,4-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
|---|---|
| PubChem CID | 91115442 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (1S)-17-[(3,4-dimethoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
| SMILES | COc1ccc(C=C2CC3CN4CCc5c([nH]c6ccccc56)[C@]4(C)CC3CC2=O)cc1OC |
| InChI | InChI=1S/C29H32N2O3/c1-29-16-20-15-25(32)19(12-18-8-9-26(33-2)27(13-18)34-3)14-21(20)17-31(29)11-10-23-22-6-4-5-7-24(22)30-28(23)29/h4-9,12-13,20-21,30H,10-11,14-17H2,1-3H3/t20?,21?,29-/m0/s1 |
| InChIKey | UPBJFOBNDBZGHG-KRGKPIPQSA-N |
| XLogP | 5.34 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|