C28H30N2O2 — CID 20703676
(17E)-17-[(3-methoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one (PubChem CID 20703676) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (17E)-17-[(3-methoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one.
| Compound Name | (17E)-17-[(3-methoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
|---|---|
| PubChem CID | 20703676 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (17E)-17-[(3-methoxyphenyl)methylidene]-1-methyl-11,12,14,15,16,19,20,21-octahydro-3H-yohimban-18-one |
| SMILES | COc1cccc(/C=C2\CC3CN4CCc5c([nH]c6ccccc56)C4(C)CC3CC2=O)c1 |
| InChI | InChI=1S/C28H30N2O2/c1-28-16-20-15-26(31)19(12-18-6-5-7-22(13-18)32-2)14-21(20)17-30(28)11-10-24-23-8-3-4-9-25(23)29-27(24)28/h3-9,12-13,20-21,29H,10-11,14-17H2,1-2H3/b19-12+ |
| InChIKey | RDVWNAYQSQUSIY-XDHOZWIPSA-N |
| XLogP | 5.33 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|