C40H30CoN2O4 — CID 139049178
bis(2-benzoylphenolate);cobalt(2+);2,9-dimethyl-1,10-phenanthroline (PubChem CID 139049178) has the molecular formula C40H30CoN2O4 and a molecular weight of 661.62 g/mol. Its IUPAC name is bis(2-benzoylphenolate);cobalt(2+);2,9-dimethyl-1,10-phenanthroline.
| Compound Name | bis(2-benzoylphenolate);cobalt(2+);2,9-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 139049178 |
| Molecular Formula | C40H30CoN2O4 |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 661.15 |
| IUPAC Name | bis(2-benzoylphenolate);cobalt(2+);2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C(c1ccccc1)c1ccccc1[O-].O=C(c1ccccc1)c1ccccc1[O-].[Co+2] |
| InChI | InChI=1S/C14H12N2.2C13H10O2.Co/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;/h3-8H,1-2H3;2*1-9,14H;/q;;;+2/p-2 |
| InChIKey | PQXZNIBLLITABF-UHFFFAOYSA-L |
| XLogP | 7.38 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|