C23H17ClN2O7S — CID 139050054
methyl (3R,4R)-3-(4-chlorophenyl)-2-(4-nitrophenyl)sulfonyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylate (PubChem CID 139050054) has the molecular formula C23H17ClN2O7S and a molecular weight of 500.92 g/mol. Its IUPAC name is methyl (3R,4R)-3-(4-chlorophenyl)-2-(4-nitrophenyl)sulfonyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylate.
| Compound Name | methyl (3R,4R)-3-(4-chlorophenyl)-2-(4-nitrophenyl)sulfonyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 139050054 |
| Molecular Formula | C23H17ClN2O7S |
| Molecular Weight | 500.92 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | methyl (3R,4R)-3-(4-chlorophenyl)-2-(4-nitrophenyl)sulfonyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
| SMILES | COC(=O)[C@@H]1c2ccccc2C(=O)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN2O7S/c1-33-23(28)20-18-4-2-3-5-19(18)22(27)25(21(20)14-6-8-15(24)9-7-14)34(31,32)17-12-10-16(11-13-17)26(29)30/h2-13,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | CVQUSOSNUPKWBR-RTWAWAEBSA-N |
| XLogP | 4.09 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|