C24H25Cl2N3O7S — CID 118421492
methyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate (PubChem CID 118421492) has the molecular formula C24H25Cl2N3O7S and a molecular weight of 570.45 g/mol. Its IUPAC name is methyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate.
| Compound Name | methyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 118421492 |
| Molecular Formula | C24H25Cl2N3O7S |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | methyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
| SMILES | COC(=O)[C@@H]1c2cc([N+](=O)[O-])ccc2C(=O)N([C@H]2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H25Cl2N3O7S/c1-36-24(31)21-17-12-14(29(32)33)8-10-15(17)23(30)28(22(21)16-9-7-13(25)11-18(16)26)20-6-4-3-5-19(20)27-37(2,34)35/h7-12,19-22,27H,3-6H2,1-2H3/t19-,20-,21+,22-/m0/s1 |
| InChIKey | LHZHUQOVTFMACN-KJJMTIBFSA-N |
| XLogP | 4.22 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|