C20H32N3O6P — CID 139050347
(3S,4aR,11bS)-5-[bis(dimethylamino)phosphoryl]-11b-(2-hydroxyethyl)-3,4,4a,6-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-3-ol;hydrate (PubChem CID 139050347) has the molecular formula C20H32N3O6P and a molecular weight of 441.47 g/mol. Its IUPAC name is (3S,4aR,11bS)-5-[bis(dimethylamino)phosphoryl]-11b-(2-hydroxyethyl)-3,4,4a,6-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-3-ol;hydrate.
| Compound Name | (3S,4aR,11bS)-5-[bis(dimethylamino)phosphoryl]-11b-(2-hydroxyethyl)-3,4,4a,6-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-3-ol;hydrate |
|---|---|
| PubChem CID | 139050347 |
| Molecular Formula | C20H32N3O6P |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (3S,4aR,11bS)-5-[bis(dimethylamino)phosphoryl]-11b-(2-hydroxyethyl)-3,4,4a,6-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-3-ol;hydrate |
| SMILES | CN(C)P(=O)(N(C)C)N1Cc2cc3c(cc2[C@]2(CCO)C=C[C@@H](O)C[C@@H]12)OCO3.O |
| InChI | InChI=1S/C20H30N3O5P.H2O/c1-21(2)29(26,22(3)4)23-12-14-9-17-18(28-13-27-17)11-16(14)20(7-8-24)6-5-15(25)10-19(20)23;/h5-6,9,11,15,19,24-25H,7-8,10,12-13H2,1-4H3;1H2/t15-,19-,20-;/m1./s1 |
| InChIKey | BDPVKJBKHNPCQV-QLVJJBLOSA-N |
| XLogP | 0.95 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|