C23H18N2O2S — CID 139051317
N-[3-(4-methoxyphenyl)-4-sulfanylidene-1H-quinolin-2-yl]benzamide (PubChem CID 139051317) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-4-sulfanylidene-1H-quinolin-2-yl]benzamide.
| Compound Name | N-[3-(4-methoxyphenyl)-4-sulfanylidene-1H-quinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 139051317 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-4-sulfanylidene-1H-quinolin-2-yl]benzamide |
| SMILES | COc1ccc(-c2c(NC(=O)c3ccccc3)[nH]c3ccccc3c2=S)cc1 |
| InChI | InChI=1S/C23H18N2O2S/c1-27-17-13-11-15(12-14-17)20-21(28)18-9-5-6-10-19(18)24-22(20)25-23(26)16-7-3-2-4-8-16/h2-14H,1H3,(H2,24,25,26,28) |
| InChIKey | MHIWXSQQGHNAAY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|