About [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid
[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid (PubChem CID 139053959) has the molecular formula C4H10N2O6P+
and a molecular weight of 213.11 g/mol. Its IUPAC name is [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid.
Molecular Properties
| Compound Name | [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid |
| PubChem CID | 139053959 |
| Molecular Formula | C4H10N2O6P+ |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid |
| SMILES | O=[P+]([O-])O.[NH3+]CC(=O)NCC(=O)O |
| InChI | InChI=1S/C4H8N2O3.HO3P/c5-1-3(7)6-2-4(8)9;1-4(2)3/h1-2,5H2,(H,6,7)(H,8,9);(H,1,2,3)/p+1 |
| InChIKey | ZPYPXHQNCGHPID-UHFFFAOYSA-O |
| XLogP | -3.57 |
| TPSA | 154.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The IUPAC name of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid (CID 139053959) is [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid.
What is the SMILES notation for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The canonical SMILES for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid is O=[P+]([O-])O.[NH3+]CC(=O)NCC(=O)O.
What is the InChIKey of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The InChIKey is ZPYPXHQNCGHPID-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H8N2O3.HO3P/c5-1-3(7)6-2-4(8)9;1-4(2)3/h1-2,5H2,(H,6,7)(H,8,9);(H,1,2,3)/p+1.
What are the key properties of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid has a molecular weight of 213.11 g/mol, XLogP of -3.57, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid is sourced from PubChem (CID 139053959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).