[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid

C4H10N2O6P+ — CID 139053959

IUPAC[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid
SMILESO=[P+]([O-])O.[NH3+]CC(=O)NCC(=O)O
InChIInChI=1S/C4H8N2O3.HO3P/c5-1-3(7)6-2-4(8)9;1-4(2)3/h1-2,5H2,(H,6,7)(H,8,9);(H,1,2,3)/p+1
InChIKeyZPYPXHQNCGHPID-UHFFFAOYSA-O
MW213.11 g/mol
LogP-3.57
Rot. Bonds3

About [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid

[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid (PubChem CID 139053959) has the molecular formula C4H10N2O6P+ and a molecular weight of 213.11 g/mol. Its IUPAC name is [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid.

Molecular Properties

Compound Name[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid
PubChem CID139053959
Molecular FormulaC4H10N2O6P+
Molecular Weight213.11 g/mol
Exact Mass213.03
IUPAC Name[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid
SMILESO=[P+]([O-])O.[NH3+]CC(=O)NCC(=O)O
InChIInChI=1S/C4H8N2O3.HO3P/c5-1-3(7)6-2-4(8)9;1-4(2)3/h1-2,5H2,(H,6,7)(H,8,9);(H,1,2,3)/p+1
InChIKeyZPYPXHQNCGHPID-UHFFFAOYSA-O
XLogP-3.57
TPSA154.40 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.11
LogP ≤ 5-3.57
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The IUPAC name of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid (CID 139053959) is [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid.
What is the SMILES notation for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The canonical SMILES for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid is O=[P+]([O-])O.[NH3+]CC(=O)NCC(=O)O.
What is the InChIKey of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
The InChIKey is ZPYPXHQNCGHPID-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H8N2O3.HO3P/c5-1-3(7)6-2-4(8)9;1-4(2)3/h1-2,5H2,(H,6,7)(H,8,9);(H,1,2,3)/p+1.
What are the key properties of [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid?
[2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid has a molecular weight of 213.11 g/mol, XLogP of -3.57, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(carboxymethylamino)-2-oxoethyl]azanium;phosphenic acid is sourced from PubChem (CID 139053959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).