C10H18N4O10 — CID 139058986
bis([2-(carboxymethylamino)-2-oxoethyl]azanium);oxalate (PubChem CID 139058986) has the molecular formula C10H18N4O10 and a molecular weight of 354.27 g/mol. Its IUPAC name is bis([2-(carboxymethylamino)-2-oxoethyl]azanium);oxalate.
| Compound Name | bis([2-(carboxymethylamino)-2-oxoethyl]azanium);oxalate |
|---|---|
| PubChem CID | 139058986 |
| Molecular Formula | C10H18N4O10 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | bis([2-(carboxymethylamino)-2-oxoethyl]azanium);oxalate |
| SMILES | O=C([O-])C(=O)[O-].[NH3+]CC(=O)NCC(=O)O.[NH3+]CC(=O)NCC(=O)O |
| InChI | InChI=1S/2C4H8N2O3.C2H2O4/c2*5-1-3(7)6-2-4(8)9;3-1(4)2(5)6/h2*1-2,5H2,(H,6,7)(H,8,9);(H,3,4)(H,5,6) |
| InChIKey | YMPLOOVRMYMRQM-UHFFFAOYSA-N |
| XLogP | -8.66 |
| TPSA | 268.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | -8.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|