C21H23NO2 — CID 139054022
(E)-1-[(2S,4S)-2,4-dibenzyl-1,3-oxazolidin-3-yl]but-2-en-1-one (PubChem CID 139054022) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-1-[(2S,4S)-2,4-dibenzyl-1,3-oxazolidin-3-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(2S,4S)-2,4-dibenzyl-1,3-oxazolidin-3-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 139054022 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-1-[(2S,4S)-2,4-dibenzyl-1,3-oxazolidin-3-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1[C@@H](Cc2ccccc2)CO[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-2-9-20(23)22-19(14-17-10-5-3-6-11-17)16-24-21(22)15-18-12-7-4-8-13-18/h2-13,19,21H,14-16H2,1H3/b9-2+/t19-,21-/m0/s1 |
| InChIKey | OZDZEBSNXKLYMK-FANJVJKXSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|