C16H16F3NO3 — CID 174484763
(4S)-4-benzyl-3-[(E)-5,5,5-trifluoropent-2-enoyl]-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174484763) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-5,5,5-trifluoropent-2-enoyl]-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | (4S)-4-benzyl-3-[(E)-5,5,5-trifluoropent-2-enoyl]-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174484763 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-5,5,5-trifluoropent-2-enoyl]-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1OC[C@H](Cc2ccccc2)N1C(=O)/C=C/CC(F)(F)F |
| InChI | InChI=1S/C16H16F3NO3/c17-16(18,19)8-4-7-14(22)20-13(11-23-15(20)10-21)9-12-5-2-1-3-6-12/h1-7,10,13,15H,8-9,11H2/b7-4+/t13-,15?/m0/s1 |
| InChIKey | KGEVKNJBXVAUJK-SYGJZSBJSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|