C16H13F3OS — CID 19561482
(E)-1-(5-benzylthiophen-2-yl)-5,5,5-trifluoropent-2-en-1-one (PubChem CID 19561482) has the molecular formula C16H13F3OS and a molecular weight of 310.34 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-5,5,5-trifluoropent-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-5,5,5-trifluoropent-2-en-1-one |
|---|---|
| PubChem CID | 19561482 |
| Molecular Formula | C16H13F3OS |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-5,5,5-trifluoropent-2-en-1-one |
| SMILES | O=C(/C=C/CC(F)(F)F)c1ccc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H13F3OS/c17-16(18,19)10-4-7-14(20)15-9-8-13(21-15)11-12-5-2-1-3-6-12/h1-9H,10-11H2/b7-4+ |
| InChIKey | VYGFNIVZXFKTTB-QPJJXVBHSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|