C29H22N2OS — CID 19561333
(E)-1-(5-benzylthiophen-2-yl)-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19561333) has the molecular formula C29H22N2OS and a molecular weight of 446.58 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19561333 |
| Molecular Formula | C29H22N2OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C29H22N2OS/c32-27(28-19-17-26(33-28)20-22-10-4-1-5-11-22)18-16-24-21-31(25-14-8-3-9-15-25)30-29(24)23-12-6-2-7-13-23/h1-19,21H,20H2/b18-16+ |
| InChIKey | VWDUZQHZBPKIIB-FBMGVBCBSA-N |
| XLogP | 7.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|