About (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid
(2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid (PubChem CID 139054898) has the molecular formula C12H28O6Si2
and a molecular weight of 324.52 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid |
| PubChem CID | 139054898 |
| Molecular Formula | C12H28O6Si2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid |
| SMILES | C[C@@](O)(C(=O)O)[Si](C)(C)C.C[C@](O)(C(=O)O)[Si](C)(C)C |
| InChI | InChI=1S/2C6H14O3Si/c2*1-6(9,5(7)8)10(2,3)4/h2*9H,1-4H3,(H,7,8)/t2*6-/m10/s1 |
| InChIKey | BKRKJTNKOLUJNA-MTPWEOJCSA-N |
| XLogP | 1.40 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid?
The IUPAC name of (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid (CID 139054898) is (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid.
What is the SMILES notation for (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid?
The canonical SMILES for (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid is C[C@@](O)(C(=O)O)[Si](C)(C)C.C[C@](O)(C(=O)O)[Si](C)(C)C.
What is the InChIKey of (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid?
The InChIKey is BKRKJTNKOLUJNA-MTPWEOJCSA-N. The full InChI is InChI=1S/2C6H14O3Si/c2*1-6(9,5(7)8)10(2,3)4/h2*9H,1-4H3,(H,7,8)/t2*6-/m10/s1.
What are the key properties of (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid?
(2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid has a molecular weight of 324.52 g/mol, XLogP of 1.40, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxy-2-trimethylsilylpropanoic acid;(2S)-2-hydroxy-2-trimethylsilylpropanoic acid is sourced from PubChem (CID 139054898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).