C15H34O3Si2 — CID 57020188
(2S)-2-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid (PubChem CID 57020188) has the molecular formula C15H34O3Si2 and a molecular weight of 318.61 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
|---|---|
| PubChem CID | 57020188 |
| Molecular Formula | C15H34O3Si2 |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@](C)(C(=O)O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34O3Si2/c1-13(2,3)19(8,9)15(7,12(16)17)18-20(10,11)14(4,5)6/h1-11H3,(H,16,17)/t15-/m0/s1 |
| InChIKey | ZKFUMQBHLJPQAQ-HNNXBMFYSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|