C28H33NO7 — CID 139055467
(3'S,3aR,5R,6R,6aR)-3'-(dibenzylamino)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-oxetane]-2'-one (PubChem CID 139055467) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (3'S,3aR,5R,6R,6aR)-3'-(dibenzylamino)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-oxetane]-2'-one.
| Compound Name | (3'S,3aR,5R,6R,6aR)-3'-(dibenzylamino)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-oxetane]-2'-one |
|---|---|
| PubChem CID | 139055467 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (3'S,3aR,5R,6R,6aR)-3'-(dibenzylamino)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-oxetane]-2'-one |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@]23OC(=O)[C@H]3N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C28H33NO7/c1-26(2)31-17-20(33-26)22-28(23-25(32-22)36-27(3,4)34-23)21(24(30)35-28)29(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14,20-23,25H,15-17H2,1-4H3/t20-,21-,22-,23+,25-,28-/m1/s1 |
| InChIKey | AJIPHDAECYLCLU-QUCBLMSRSA-N |
| XLogP | 3.38 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|