C11H11IN4O — CID 139056274
2-(4,5-dihydro-1H-imidazol-3-ium-2-yl)phthalazin-1-one iodide (PubChem CID 139056274) has the molecular formula C11H11IN4O and a molecular weight of 342.14 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-3-ium-2-yl)phthalazin-1-one iodide.
| Compound Name | 2-(4,5-dihydro-1H-imidazol-3-ium-2-yl)phthalazin-1-one iodide |
|---|---|
| PubChem CID | 139056274 |
| Molecular Formula | C11H11IN4O |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-3-ium-2-yl)phthalazin-1-one iodide |
| SMILES | O=c1c2ccccc2cnn1C1=[NH+]CCN1.[I-] |
| InChI | InChI=1S/C11H10N4O.HI/c16-10-9-4-2-1-3-8(9)7-14-15(10)11-12-5-6-13-11;/h1-4,7H,5-6H2,(H,12,13);1H |
| InChIKey | HUFHTJAXSMAEOX-UHFFFAOYSA-N |
| XLogP | -4.71 |
| TPSA | 60.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|