C17H27ClO2S — CID 139056994
(1R,4S,5S,8S,10R,11S)-11-chloro-5-methyl-4-[(2-methylpropan-2-yl)oxy]-10-methylsulfanyltricyclo[6.2.1.01,5]undecan-9-one (PubChem CID 139056994) has the molecular formula C17H27ClO2S and a molecular weight of 330.92 g/mol. Its IUPAC name is (1R,4S,5S,8S,10R,11S)-11-chloro-5-methyl-4-[(2-methylpropan-2-yl)oxy]-10-methylsulfanyltricyclo[6.2.1.01,5]undecan-9-one.
| Compound Name | (1R,4S,5S,8S,10R,11S)-11-chloro-5-methyl-4-[(2-methylpropan-2-yl)oxy]-10-methylsulfanyltricyclo[6.2.1.01,5]undecan-9-one |
|---|---|
| PubChem CID | 139056994 |
| Molecular Formula | C17H27ClO2S |
| Molecular Weight | 330.92 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1R,4S,5S,8S,10R,11S)-11-chloro-5-methyl-4-[(2-methylpropan-2-yl)oxy]-10-methylsulfanyltricyclo[6.2.1.01,5]undecan-9-one |
| SMILES | CS[C@H]1C(=O)[C@@H]2CC[C@]3(C)[C@@H](OC(C)(C)C)CC[C@]13[C@H]2Cl |
| InChI | InChI=1S/C17H27ClO2S/c1-15(2,3)20-11-7-9-17-13(18)10(6-8-16(11,17)4)12(19)14(17)21-5/h10-11,13-14H,6-9H2,1-5H3/t10-,11-,13-,14-,16+,17-/m0/s1 |
| InChIKey | CPBYXYYMQXNSAD-BZIPOHERSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|