C15H26O4 — CID 102586486
(2S,3aR,4S,7aS)-2-methoxy-3a-methyl-4-[(2-methylpropan-2-yl)oxy]-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-carbaldehyde (PubChem CID 102586486) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2S,3aR,4S,7aS)-2-methoxy-3a-methyl-4-[(2-methylpropan-2-yl)oxy]-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-carbaldehyde.
| Compound Name | (2S,3aR,4S,7aS)-2-methoxy-3a-methyl-4-[(2-methylpropan-2-yl)oxy]-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-carbaldehyde |
|---|---|
| PubChem CID | 102586486 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2S,3aR,4S,7aS)-2-methoxy-3a-methyl-4-[(2-methylpropan-2-yl)oxy]-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-carbaldehyde |
| SMILES | CO[C@@H]1C[C@]2(C)[C@@H](OC(C)(C)C)CCC[C@]2(C=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-13(2,3)18-11-7-6-8-15(10-16)14(11,4)9-12(17-5)19-15/h10-12H,6-9H2,1-5H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | WJURECDLJUVOPS-DDHJSBNISA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|