C19H21CuN7S2 — CID 139057625
copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;diisothiocyanate (PubChem CID 139057625) has the molecular formula C19H21CuN7S2 and a molecular weight of 475.11 g/mol. Its IUPAC name is copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;diisothiocyanate.
| Compound Name | copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;diisothiocyanate |
|---|---|
| PubChem CID | 139057625 |
| Molecular Formula | C19H21CuN7S2 |
| Molecular Weight | 475.11 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;diisothiocyanate |
| SMILES | Cc1cc(C)n(Cc2cccc(Cn3nc(C)cc3C)n2)n1.[Cu+2].[N-]=C=S.[N-]=C=S |
| InChI | InChI=1S/C17H21N5.2CNS.Cu/c1-12-8-14(3)21(19-12)10-16-6-5-7-17(18-16)11-22-15(4)9-13(2)20-22;2*2-1-3;/h5-9H,10-11H2,1-4H3;;;/q;2*-1;+2 |
| InChIKey | UTTQICYZGUTMKD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.11 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|