C17H21CuN7O6 — CID 139153785
copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;dinitrate (PubChem CID 139153785) has the molecular formula C17H21CuN7O6 and a molecular weight of 482.94 g/mol. Its IUPAC name is copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;dinitrate.
| Compound Name | copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;dinitrate |
|---|---|
| PubChem CID | 139153785 |
| Molecular Formula | C17H21CuN7O6 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | copper;2,6-bis[(3,5-dimethylpyrazol-1-yl)methyl]pyridine;dinitrate |
| SMILES | Cc1cc(C)n(Cc2cccc(Cn3nc(C)cc3C)n2)n1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C17H21N5.Cu.2NO3/c1-12-8-14(3)21(19-12)10-16-6-5-7-17(18-16)11-22-15(4)9-13(2)20-22;;2*2-1(3)4/h5-9H,10-11H2,1-4H3;;;/q;+2;2*-1 |
| InChIKey | KGCMIYWJFFNRPD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 180.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|