C64H112O12S4Si2 — CID 139057662
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentan-1-ol (PubChem CID 139057662) has the molecular formula C64H112O12S4Si2 and a molecular weight of 1258.03 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentan-1-ol.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 139057662 |
| Molecular Formula | C64H112O12S4Si2 |
| Molecular Weight | 1258.03 g/mol |
| Exact Mass | 1256.66 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentan-1-ol |
| SMILES | COC1(OC)C[C@H](COCc2ccccc2)O[C@H](CC2(C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C)SCCCS2)C1.COC1(OC)C[C@H](COCc2ccccc2)O[C@H](CC2(C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C)SCCCS2)C1 |
| InChI | InChI=1S/2C32H56O6S2Si/c2*1-29(2,3)41(8,9)38-28(16-17-33)30(4,5)32(39-18-13-19-40-32)22-26-20-31(34-6,35-7)21-27(37-26)24-36-23-25-14-11-10-12-15-25/h2*10-12,14-15,26-28,33H,13,16-24H2,1-9H3/t2*26-,27+,28-/m00/s1 |
| InChIKey | FXSHRDZDLOGXJW-GOJLZVFISA-N |
| XLogP | 14.99 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1258.03 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|