C16H12N2O4 — CID 139058138
2,5-dihydroxycyclohexa-2,5-diene-1,4-dione;4-pyridin-4-ylpyridine (PubChem CID 139058138) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione;4-pyridin-4-ylpyridine.
| Compound Name | 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione;4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139058138 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione;4-pyridin-4-ylpyridine |
| SMILES | O=C1C=C(O)C(=O)C=C1O.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C6H4O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;7-3-1-4(8)6(10)2-5(3)9/h1-8H;1-2,7,10H |
| InChIKey | WPWCUQNCCKEPFF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|