C20H26O10 — CID 139060410
tetramethyl (1R,3aR,4R,6aR)-2,5-dimethoxy-3a,6a-dimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 139060410) has the molecular formula C20H26O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is tetramethyl (1R,3aR,4R,6aR)-2,5-dimethoxy-3a,6a-dimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl (1R,3aR,4R,6aR)-2,5-dimethoxy-3a,6a-dimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 139060410 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | tetramethyl (1R,3aR,4R,6aR)-2,5-dimethoxy-3a,6a-dimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(OC)[C@H](C(=O)OC)[C@@]2(C)C(C(=O)OC)=C(OC)[C@H](C(=O)OC)[C@@]12C |
| InChI | InChI=1S/C20H26O10/c1-19-9(15(21)27-5)13(25-3)11(17(23)29-7)20(19,2)12(18(24)30-8)14(26-4)10(19)16(22)28-6/h9,12H,1-8H3/t9-,12-,19+,20-/m1/s1 |
| InChIKey | LYQLAKSUFWPGCX-AQZQYTFCSA-N |
| XLogP | 0.75 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|