C7H10N2O4S2 — CID 139062271
methylsulfinylmethane;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (PubChem CID 139062271) has the molecular formula C7H10N2O4S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is methylsulfinylmethane;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
| Compound Name | methylsulfinylmethane;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 139062271 |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | methylsulfinylmethane;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| SMILES | CS(C)=O.O=C(O)c1c[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C5H4N2O3S.C2H6OS/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(2)3/h1H,(H,9,10)(H2,6,7,8,11);1-2H3 |
| InChIKey | QLNBGRAMUGVNNQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|