C6H6N2O3S — CID 19063379
3-methyl-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (PubChem CID 19063379) has the molecular formula C6H6N2O3S and a molecular weight of 186.19 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 3-methyl-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 19063379 |
| Molecular Formula | C6H6N2O3S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 3-methyl-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cn1c(=S)[nH]cc(C(=O)O)c1=O |
| InChI | InChI=1S/C6H6N2O3S/c1-8-4(9)3(5(10)11)2-7-6(8)12/h2H,1H3,(H,7,12)(H,10,11) |
| InChIKey | IIWBZOJOGBLJAE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|