About N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid
N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (PubChem CID 139062270) has the molecular formula C8H11N3O4S
and a molecular weight of 245.26 g/mol. Its IUPAC name is N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| PubChem CID | 139062270 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| SMILES | CN(C)C=O.O=C(O)c1c[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C5H4N2O3S.C3H7NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(2)3-5/h1H,(H,9,10)(H2,6,7,8,11);3H,1-2H3 |
| InChIKey | LLHYUCKKMLRYGC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (CID 139062270) is N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid is CN(C)C=O.O=C(O)c1c[nH]c(=S)[nH]c1=O.
What is the InChIKey of N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid?
The InChIKey is LLHYUCKKMLRYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3S.C3H7NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(2)3-5/h1H,(H,9,10)(H2,6,7,8,11);3H,1-2H3.
What are the key properties of N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid?
N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid has a molecular weight of 245.26 g/mol, XLogP of -0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 139062270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).