C8H11N3O4S — CID 139062270
N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (PubChem CID 139062270) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
| Compound Name | N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 139062270 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N,N-dimethylformamide;4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| SMILES | CN(C)C=O.O=C(O)c1c[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C5H4N2O3S.C3H7NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(2)3-5/h1H,(H,9,10)(H2,6,7,8,11);3H,1-2H3 |
| InChIKey | LLHYUCKKMLRYGC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|